C19H17Cl3N2O2 — CID 66760143
ethyl 3-(4-chlorophenyl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)butanoate (PubChem CID 66760143) has the molecular formula C19H17Cl3N2O2 and a molecular weight of 411.72 g/mol. Its IUPAC name is ethyl 3-(4-chlorophenyl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)butanoate.
| Compound Name | ethyl 3-(4-chlorophenyl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)butanoate |
|---|---|
| PubChem CID | 66760143 |
| Molecular Formula | C19H17Cl3N2O2 |
| Molecular Weight | 411.72 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | ethyl 3-(4-chlorophenyl)-4-(5,6-dichloro-1H-benzimidazol-2-yl)butanoate |
| SMILES | CCOC(=O)CC(Cc1nc2cc(Cl)c(Cl)cc2[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H17Cl3N2O2/c1-2-26-19(25)8-12(11-3-5-13(20)6-4-11)7-18-23-16-9-14(21)15(22)10-17(16)24-18/h3-6,9-10,12H,2,7-8H2,1H3,(H,23,24) |
| InChIKey | BSUWIKVBASBVQZ-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.72 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |