About 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid
3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid (PubChem CID 45380983) has the molecular formula C17H13ClF2N2O2
and a molecular weight of 350.75 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid |
| PubChem CID | 45380983 |
| Molecular Formula | C17H13ClF2N2O2 |
| Molecular Weight | 350.75 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid |
| SMILES | O=C(O)CC(Cc1nc2cc(F)c(F)cc2[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H13ClF2N2O2/c18-11-3-1-9(2-4-11)10(6-17(23)24)5-16-21-14-7-12(19)13(20)8-15(14)22-16/h1-4,7-8,10H,5-6H2,(H,21,22)(H,23,24) |
| InChIKey | WDQQQFDVABRXFU-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.75 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid?
The IUPAC name of 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid (CID 45380983) is 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid.
What is the SMILES notation for 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid?
The canonical SMILES for 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid is O=C(O)CC(Cc1nc2cc(F)c(F)cc2[nH]1)c1ccc(Cl)cc1.
What is the InChIKey of 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid?
The InChIKey is WDQQQFDVABRXFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13ClF2N2O2/c18-11-3-1-9(2-4-11)10(6-17(23)24)5-16-21-14-7-12(19)13(20)8-15(14)22-16/h1-4,7-8,10H,5-6H2,(H,21,22)(H,23,24).
What are the key properties of 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid?
3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid has a molecular weight of 350.75 g/mol, XLogP of 4.30, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-4-(5,6-difluoro-1H-benzimidazol-2-yl)butanoic acid is sourced from PubChem (CID 45380983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).