C17H16ClN3O2 — CID 18349352
4-(1H-benzimidazol-2-ylamino)-3-(4-chlorophenyl)butanoic acid (PubChem CID 18349352) has the molecular formula C17H16ClN3O2 and a molecular weight of 329.79 g/mol. Its IUPAC name is 4-(1H-benzimidazol-2-ylamino)-3-(4-chlorophenyl)butanoic acid.
| Compound Name | 4-(1H-benzimidazol-2-ylamino)-3-(4-chlorophenyl)butanoic acid |
|---|---|
| PubChem CID | 18349352 |
| Molecular Formula | C17H16ClN3O2 |
| Molecular Weight | 329.79 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | 4-(1H-benzimidazol-2-ylamino)-3-(4-chlorophenyl)butanoic acid |
| SMILES | O=C(O)CC(CNc1nc2ccccc2[nH]1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClN3O2/c18-13-7-5-11(6-8-13)12(9-16(22)23)10-19-17-20-14-3-1-2-4-15(14)21-17/h1-8,12H,9-10H2,(H,22,23)(H2,19,20,21) |
| InChIKey | AMLXLYFUEVBYRJ-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.79 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |