C20H26Cl2N2O6 — CID 76973340
5-[2-carboxyethyl(pentyl)amino]-2,2,3,3,4-pentadeuterio-4-[(3,4-dichlorobenzoyl)amino]-5-oxopentanoic acid (PubChem CID 76973340) has the molecular formula C20H26Cl2N2O6 and a molecular weight of 466.37 g/mol. Its IUPAC name is 5-[2-carboxyethyl(pentyl)amino]-2,2,3,3,4-pentadeuterio-4-[(3,4-dichlorobenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[2-carboxyethyl(pentyl)amino]-2,2,3,3,4-pentadeuterio-4-[(3,4-dichlorobenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 76973340 |
| Molecular Formula | C20H26Cl2N2O6 |
| Molecular Weight | 466.37 g/mol |
| Exact Mass | 465.15 |
| IUPAC Name | 5-[2-carboxyethyl(pentyl)amino]-2,2,3,3,4-pentadeuterio-4-[(3,4-dichlorobenzoyl)amino]-5-oxopentanoic acid |
| SMILES | [2H]C([2H])(C(=O)O)C([2H])([2H])C([2H])(NC(=O)c1ccc(Cl)c(Cl)c1)C(=O)N(CCCCC)CCC(=O)O |
| InChI | InChI=1S/C20H26Cl2N2O6/c1-2-3-4-10-24(11-9-18(27)28)20(30)16(7-8-17(25)26)23-19(29)13-5-6-14(21)15(22)12-13/h5-6,12,16H,2-4,7-11H2,1H3,(H,23,29)(H,25,26)(H,27,28)/i7D2,8D2,16D |
| InChIKey | IRNCSRWXPWJUQU-IYMOSOEYSA-N |
| XLogP | 3.45 |
| TPSA | 124.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|