C17H23ClN2O4 — CID 67832580
5-[butyl(methyl)amino]-4-[(3-chlorobenzoyl)amino]-5-oxopentanoic acid (PubChem CID 67832580) has the molecular formula C17H23ClN2O4 and a molecular weight of 354.83 g/mol. Its IUPAC name is 5-[butyl(methyl)amino]-4-[(3-chlorobenzoyl)amino]-5-oxopentanoic acid.
| Compound Name | 5-[butyl(methyl)amino]-4-[(3-chlorobenzoyl)amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 67832580 |
| Molecular Formula | C17H23ClN2O4 |
| Molecular Weight | 354.83 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 5-[butyl(methyl)amino]-4-[(3-chlorobenzoyl)amino]-5-oxopentanoic acid |
| SMILES | CCCCN(C)C(=O)C(CCC(=O)O)NC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H23ClN2O4/c1-3-4-10-20(2)17(24)14(8-9-15(21)22)19-16(23)12-6-5-7-13(18)11-12/h5-7,11,14H,3-4,8-10H2,1-2H3,(H,19,23)(H,21,22) |
| InChIKey | LYDMWQMCMACHRS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |