C28H39NO7S — CID 10530335
5-[2-(2,2-dimethylpropanoyloxy)ethyl-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid (PubChem CID 10530335) has the molecular formula C28H39NO7S and a molecular weight of 533.69 g/mol. Its IUPAC name is 5-[2-(2,2-dimethylpropanoyloxy)ethyl-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid.
| Compound Name | 5-[2-(2,2-dimethylpropanoyloxy)ethyl-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 10530335 |
| Molecular Formula | C28H39NO7S |
| Molecular Weight | 533.69 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 5-[2-(2,2-dimethylpropanoyloxy)ethyl-pentylamino]-4-(naphthalen-2-ylsulfonylmethyl)-5-oxopentanoic acid |
| SMILES | CCCCCN(CCOC(=O)C(C)(C)C)C(=O)C(CCC(=O)O)CS(=O)(=O)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C28H39NO7S/c1-5-6-9-16-29(17-18-36-27(33)28(2,3)4)26(32)23(13-15-25(30)31)20-37(34,35)24-14-12-21-10-7-8-11-22(21)19-24/h7-8,10-12,14,19,23H,5-6,9,13,15-18,20H2,1-4H3,(H,30,31) |
| InChIKey | PDGXKSDXKLYOTI-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 118.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.69 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|