C25H37N5O8S — CID 86735469
ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(4,6-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate (PubChem CID 86735469) has the molecular formula C25H37N5O8S and a molecular weight of 567.67 g/mol. Its IUPAC name is ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(4,6-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(4,6-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 86735469 |
| Molecular Formula | C25H37N5O8S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.24 |
| IUPAC Name | ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(4,6-dimethoxynaphthalen-2-yl)sulfonylamino]pentanoyl]-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)[C@H](CCCN=C(N)N)NS(=O)(=O)c1cc(OC)c2cc(OC)ccc2c1 |
| InChI | InChI=1S/C25H37N5O8S/c1-5-38-23(31)16-30(11-12-35-2)24(32)21(7-6-10-28-25(26)27)29-39(33,34)19-13-17-8-9-18(36-3)14-20(17)22(15-19)37-4/h8-9,13-15,21,29H,5-7,10-12,16H2,1-4H3,(H4,26,27,28)/t21-/m0/s1 |
| InChIKey | BGYHXOXMVDUIAR-NRFANRHFSA-N |
| XLogP | 0.60 |
| TPSA | 184.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|