C25H36N6O10S — CID 86735166
ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonyl-nitroamino]pentanoyl]-(2-methoxyethyl)amino]acetate (PubChem CID 86735166) has the molecular formula C25H36N6O10S and a molecular weight of 612.66 g/mol. Its IUPAC name is ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonyl-nitroamino]pentanoyl]-(2-methoxyethyl)amino]acetate.
| Compound Name | ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonyl-nitroamino]pentanoyl]-(2-methoxyethyl)amino]acetate |
|---|---|
| PubChem CID | 86735166 |
| Molecular Formula | C25H36N6O10S |
| Molecular Weight | 612.66 g/mol |
| Exact Mass | 612.22 |
| IUPAC Name | ethyl 2-[[(2S)-5-(diaminomethylideneamino)-2-[(6,7-dimethoxynaphthalen-2-yl)sulfonyl-nitroamino]pentanoyl]-(2-methoxyethyl)amino]acetate |
| SMILES | CCOC(=O)CN(CCOC)C(=O)[C@H](CCCN=C(N)N)N([N+](=O)[O-])S(=O)(=O)c1ccc2cc(OC)c(OC)cc2c1 |
| InChI | InChI=1S/C25H36N6O10S/c1-5-41-23(32)16-29(11-12-38-2)24(33)20(7-6-10-28-25(26)27)30(31(34)35)42(36,37)19-9-8-17-14-21(39-3)22(40-4)15-18(17)13-19/h8-9,13-15,20H,5-7,10-12,16H2,1-4H3,(H4,26,27,28)/t20-/m0/s1 |
| InChIKey | RCZLZZNNLWOEFI-FQEVSTJZSA-N |
| XLogP | 0.50 |
| TPSA | 219.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.66 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'} |
|---|