C16H26N4O5 — CID 174906848
(2S)-5-(diaminomethylideneamino)-2-(2,4,6-trimethoxy-N-methylanilino)pentanoic acid (PubChem CID 174906848) has the molecular formula C16H26N4O5 and a molecular weight of 354.41 g/mol. Its IUPAC name is (2S)-5-(diaminomethylideneamino)-2-(2,4,6-trimethoxy-N-methylanilino)pentanoic acid.
| Compound Name | (2S)-5-(diaminomethylideneamino)-2-(2,4,6-trimethoxy-N-methylanilino)pentanoic acid |
|---|---|
| PubChem CID | 174906848 |
| Molecular Formula | C16H26N4O5 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.19 |
| IUPAC Name | (2S)-5-(diaminomethylideneamino)-2-(2,4,6-trimethoxy-N-methylanilino)pentanoic acid |
| SMILES | COc1cc(OC)c(N(C)[C@@H](CCCN=C(N)N)C(=O)O)c(OC)c1 |
| InChI | InChI=1S/C16H26N4O5/c1-20(11(15(21)22)6-5-7-19-16(17)18)14-12(24-3)8-10(23-2)9-13(14)25-4/h8-9,11H,5-7H2,1-4H3,(H,21,22)(H4,17,18,19)/t11-/m0/s1 |
| InChIKey | AIRJKKRFXKAHBY-NSHDSACASA-N |
| XLogP | 0.66 |
| TPSA | 132.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|