C22H28N4O4 — CID 54002623
(2S)-2-[acetyl(2,2-diphenylethoxy)amino]-5-(diaminomethylideneamino)pentanoic acid (PubChem CID 54002623) has the molecular formula C22H28N4O4 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2S)-2-[acetyl(2,2-diphenylethoxy)amino]-5-(diaminomethylideneamino)pentanoic acid.
| Compound Name | (2S)-2-[acetyl(2,2-diphenylethoxy)amino]-5-(diaminomethylideneamino)pentanoic acid |
|---|---|
| PubChem CID | 54002623 |
| Molecular Formula | C22H28N4O4 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.21 |
| IUPAC Name | (2S)-2-[acetyl(2,2-diphenylethoxy)amino]-5-(diaminomethylideneamino)pentanoic acid |
| SMILES | CC(=O)N(OCC(c1ccccc1)c1ccccc1)[C@@H](CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C22H28N4O4/c1-16(27)26(20(21(28)29)13-8-14-25-22(23)24)30-15-19(17-9-4-2-5-10-17)18-11-6-3-7-12-18/h2-7,9-12,19-20H,8,13-15H2,1H3,(H,28,29)(H4,23,24,25)/t20-/m0/s1 |
| InChIKey | KMRIAZUMMBUSPJ-FQEVSTJZSA-N |
| XLogP | 2.11 |
| TPSA | 131.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|