C21H34N4O7S — CID 124519068
(2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,5-trimethylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid (PubChem CID 124519068) has the molecular formula C21H34N4O7S and a molecular weight of 486.59 g/mol. Its IUPAC name is (2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,5-trimethylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid.
| Compound Name | (2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,5-trimethylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 124519068 |
| Molecular Formula | C21H34N4O7S |
| Molecular Weight | 486.59 g/mol |
| Exact Mass | 486.21 |
| IUPAC Name | (2R)-5-(diaminomethylideneamino)-2-[(4-methoxy-2,3,5-trimethylphenyl)sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]pentanoic acid |
| SMILES | COc1c(C)cc(S(=O)(=O)N(C(=O)OC(C)(C)C)[C@H](CCCN=C(N)N)C(=O)O)c(C)c1C |
| InChI | InChI=1S/C21H34N4O7S/c1-12-11-16(13(2)14(3)17(12)31-7)33(29,30)25(20(28)32-21(4,5)6)15(18(26)27)9-8-10-24-19(22)23/h11,15H,8-10H2,1-7H3,(H,26,27)(H4,22,23,24)/t15-/m1/s1 |
| InChIKey | AXWNHNUMCUCXME-OAHLLOKOSA-N |
| XLogP | 2.05 |
| TPSA | 174.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.59 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|