C27H38N4O6S — CID 54269053
benzyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonyl-(2,4,6-trimethylphenyl)sulfonylamino]pentanoate (PubChem CID 54269053) has the molecular formula C27H38N4O6S and a molecular weight of 546.69 g/mol. Its IUPAC name is benzyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonyl-(2,4,6-trimethylphenyl)sulfonylamino]pentanoate.
| Compound Name | benzyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonyl-(2,4,6-trimethylphenyl)sulfonylamino]pentanoate |
|---|---|
| PubChem CID | 54269053 |
| Molecular Formula | C27H38N4O6S |
| Molecular Weight | 546.69 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | benzyl (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonyl-(2,4,6-trimethylphenyl)sulfonylamino]pentanoate |
| SMILES | Cc1cc(C)c(S(=O)(=O)N(C(=O)OC(C)(C)C)[C@@H](CCCN=C(N)N)C(=O)OCc2ccccc2)c(C)c1 |
| InChI | InChI=1S/C27H38N4O6S/c1-18-15-19(2)23(20(3)16-18)38(34,35)31(26(33)37-27(4,5)6)22(13-10-14-30-25(28)29)24(32)36-17-21-11-8-7-9-12-21/h7-9,11-12,15-16,22H,10,13-14,17H2,1-6H3,(H4,28,29,30)/t22-/m0/s1 |
| InChIKey | RIWAWFDPADSLST-QFIPXVFZSA-N |
| XLogP | 3.70 |
| TPSA | 154.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.69 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|