C8H17FN4O — CID 175991669
2-[(4S)-4-[fluoro(methyl)amino]-5-oxohexyl]guanidine (PubChem CID 175991669) has the molecular formula C8H17FN4O and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-[(4S)-4-[fluoro(methyl)amino]-5-oxohexyl]guanidine.
| Compound Name | 2-[(4S)-4-[fluoro(methyl)amino]-5-oxohexyl]guanidine |
|---|---|
| PubChem CID | 175991669 |
| Molecular Formula | C8H17FN4O |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | 2-[(4S)-4-[fluoro(methyl)amino]-5-oxohexyl]guanidine |
| SMILES | CC(=O)[C@H](CCCN=C(N)N)N(C)F |
| InChI | InChI=1S/C8H17FN4O/c1-6(14)7(13(2)9)4-3-5-12-8(10)11/h7H,3-5H2,1-2H3,(H4,10,11,12)/t7-/m0/s1 |
| InChIKey | AEFMHUKCJGNFQP-ZETCQYMHSA-N |
| XLogP | -0.19 |
| TPSA | 84.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|