C13H22N2O3 — CID 117039921
2-N-methyl-2-N-(2,4,6-trimethoxyphenyl)propane-1,2-diamine (PubChem CID 117039921) has the molecular formula C13H22N2O3 and a molecular weight of 254.33 g/mol. Its IUPAC name is 2-N-methyl-2-N-(2,4,6-trimethoxyphenyl)propane-1,2-diamine.
| Compound Name | 2-N-methyl-2-N-(2,4,6-trimethoxyphenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 117039921 |
| Molecular Formula | C13H22N2O3 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.16 |
| IUPAC Name | 2-N-methyl-2-N-(2,4,6-trimethoxyphenyl)propane-1,2-diamine |
| SMILES | COc1cc(OC)c(N(C)C(C)CN)c(OC)c1 |
| InChI | InChI=1S/C13H22N2O3/c1-9(8-14)15(2)13-11(17-4)6-10(16-3)7-12(13)18-5/h6-7,9H,8,14H2,1-5H3 |
| InChIKey | YLUAICKPODSGBO-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|