C13H22N2O2 — CID 117039909
2-N-(2,4-dimethoxy-3-methylphenyl)-2-N-methylpropane-1,2-diamine (PubChem CID 117039909) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is 2-N-(2,4-dimethoxy-3-methylphenyl)-2-N-methylpropane-1,2-diamine.
| Compound Name | 2-N-(2,4-dimethoxy-3-methylphenyl)-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 117039909 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 2-N-(2,4-dimethoxy-3-methylphenyl)-2-N-methylpropane-1,2-diamine |
| SMILES | COc1ccc(N(C)C(C)CN)c(OC)c1C |
| InChI | InChI=1S/C13H22N2O2/c1-9(8-14)15(3)11-6-7-12(16-4)10(2)13(11)17-5/h6-7,9H,8,14H2,1-5H3 |
| InChIKey | JNBFTYCSBZJSPP-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|