C12H19NO3 — CID 115216133
2-(2,4-dimethoxy-N,3-dimethylanilino)ethanol (PubChem CID 115216133) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 2-(2,4-dimethoxy-N,3-dimethylanilino)ethanol.
| Compound Name | 2-(2,4-dimethoxy-N,3-dimethylanilino)ethanol |
|---|---|
| PubChem CID | 115216133 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 2-(2,4-dimethoxy-N,3-dimethylanilino)ethanol |
| SMILES | COc1ccc(N(C)CCO)c(OC)c1C |
| InChI | InChI=1S/C12H19NO3/c1-9-11(15-3)6-5-10(12(9)16-4)13(2)7-8-14/h5-6,14H,7-8H2,1-4H3 |
| InChIKey | QXWDVVPPYJPNMG-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|