C14H24N2O — CID 103434185
N'-(2-methoxy-3,4-dimethylphenyl)-N,N'-dimethylpropane-1,3-diamine (PubChem CID 103434185) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is N'-(2-methoxy-3,4-dimethylphenyl)-N,N'-dimethylpropane-1,3-diamine.
| Compound Name | N'-(2-methoxy-3,4-dimethylphenyl)-N,N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 103434185 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | N'-(2-methoxy-3,4-dimethylphenyl)-N,N'-dimethylpropane-1,3-diamine |
| SMILES | CNCCCN(C)c1ccc(C)c(C)c1OC |
| InChI | InChI=1S/C14H24N2O/c1-11-7-8-13(14(17-5)12(11)2)16(4)10-6-9-15-3/h7-8,15H,6,9-10H2,1-5H3 |
| InChIKey | NTXKHYUBYPMSBB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|