C27H40N6O6 — CID 54464423
ethyl 3-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate (PubChem CID 54464423) has the molecular formula C27H40N6O6 and a molecular weight of 544.65 g/mol. Its IUPAC name is ethyl 3-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate.
| Compound Name | ethyl 3-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate |
|---|---|
| PubChem CID | 54464423 |
| Molecular Formula | C27H40N6O6 |
| Molecular Weight | 544.65 g/mol |
| Exact Mass | 544.30 |
| IUPAC Name | ethyl 3-[cyclopropyl-[(2S)-4-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methylamino]-4-oxo-2-(phenylmethoxycarbonylamino)butanoyl]amino]propanoate |
| SMILES | CCOC(=O)CCN(C(=O)[C@H](CC(=O)NC[C@@H]1CCCN(C=NN)C1)NC(=O)OCc1ccccc1)C1CC1 |
| InChI | InChI=1S/C27H40N6O6/c1-2-38-25(35)12-14-33(22-10-11-22)26(36)23(31-27(37)39-18-20-7-4-3-5-8-20)15-24(34)29-16-21-9-6-13-32(17-21)19-30-28/h3-5,7-8,19,21-23H,2,6,9-18,28H2,1H3,(H,29,34)(H,31,37)/t21-,23-/m0/s1 |
| InChIKey | XDVZAMYRQVPOBY-GMAHTHKFSA-N |
| XLogP | 1.35 |
| TPSA | 155.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.65 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|