C26H43ClN10O4 — CID 67746241
(2S)-N-cyclopropyl-2-[3-(dimethylamino)propanoylamino]-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]butanediamide;hydrochloride (PubChem CID 67746241) has the molecular formula C26H43ClN10O4 and a molecular weight of 595.15 g/mol. Its IUPAC name is (2S)-N-cyclopropyl-2-[3-(dimethylamino)propanoylamino]-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]butanediamide;hydrochloride.
| Compound Name | (2S)-N-cyclopropyl-2-[3-(dimethylamino)propanoylamino]-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]butanediamide;hydrochloride |
|---|---|
| PubChem CID | 67746241 |
| Molecular Formula | C26H43ClN10O4 |
| Molecular Weight | 595.15 g/mol |
| Exact Mass | 594.32 |
| IUPAC Name | (2S)-N-cyclopropyl-2-[3-(dimethylamino)propanoylamino]-N'-[[(3S)-1-methanehydrazonoylpiperidin-3-yl]methyl]-N-[2-(pyrazine-2-carbonylamino)ethyl]butanediamide;hydrochloride |
| SMILES | CN(C)CCC(=O)N[C@@H](CC(=O)NC[C@@H]1CCCN(C=NN)C1)C(=O)N(CCNC(=O)c1cnccn1)C1CC1.Cl |
| InChI | InChI=1S/C26H42N10O4.ClH/c1-34(2)12-7-23(37)33-21(14-24(38)31-15-19-4-3-11-35(17-19)18-32-27)26(40)36(20-5-6-20)13-10-30-25(39)22-16-28-8-9-29-22;/h8-9,16,18-21H,3-7,10-15,17,27H2,1-2H3,(H,30,39)(H,31,38)(H,33,37);1H/t19-,21-;/m0./s1 |
| InChIKey | VCWRKGINIJZMGL-RQBPZYBGSA-N |
| XLogP | -0.82 |
| TPSA | 178.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.15 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|