C27H41N5O5S — CID 70049330
3-[[(2S)-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-2-[(4-cyclopentylphenyl)sulfonylamino]butanoyl]-cyclopropylamino]propanoic acid (PubChem CID 70049330) has the molecular formula C27H41N5O5S and a molecular weight of 547.72 g/mol. Its IUPAC name is 3-[[(2S)-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-2-[(4-cyclopentylphenyl)sulfonylamino]butanoyl]-cyclopropylamino]propanoic acid.
| Compound Name | 3-[[(2S)-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-2-[(4-cyclopentylphenyl)sulfonylamino]butanoyl]-cyclopropylamino]propanoic acid |
|---|---|
| PubChem CID | 70049330 |
| Molecular Formula | C27H41N5O5S |
| Molecular Weight | 547.72 g/mol |
| Exact Mass | 547.28 |
| IUPAC Name | 3-[[(2S)-4-[(3S)-1-carbamimidoylpiperidin-3-yl]-2-[(4-cyclopentylphenyl)sulfonylamino]butanoyl]-cyclopropylamino]propanoic acid |
| SMILES | [H]/N=C(\N)N1CCC[C@@H](CC[C@H](NS(=O)(=O)c2ccc(C3CCCC3)cc2)C(=O)N(CCC(=O)O)C2CC2)C1 |
| InChI | InChI=1S/C27H41N5O5S/c28-27(29)31-16-3-4-19(18-31)7-14-24(26(35)32(22-10-11-22)17-15-25(33)34)30-38(36,37)23-12-8-21(9-13-23)20-5-1-2-6-20/h8-9,12-13,19-20,22,24,30H,1-7,10-11,14-18H2,(H3,28,29)(H,33,34)/t19-,24-/m0/s1 |
| InChIKey | QXTNXUZQOKJNPH-CYFREDJKSA-N |
| XLogP | 2.84 |
| TPSA | 156.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.72 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|