C21H28N4O2 — CID 59749372
3-[(2S)-2-amino-3-(4-piperidin-4-yloxyphenyl)propoxy]benzenecarboximidamide (PubChem CID 59749372) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[(2S)-2-amino-3-(4-piperidin-4-yloxyphenyl)propoxy]benzenecarboximidamide.
| Compound Name | 3-[(2S)-2-amino-3-(4-piperidin-4-yloxyphenyl)propoxy]benzenecarboximidamide |
|---|---|
| PubChem CID | 59749372 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | 3-[(2S)-2-amino-3-(4-piperidin-4-yloxyphenyl)propoxy]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(OC[C@@H](N)Cc2ccc(OC3CCNCC3)cc2)c1 |
| InChI | InChI=1S/C21H28N4O2/c22-17(14-26-20-3-1-2-16(13-20)21(23)24)12-15-4-6-18(7-5-15)27-19-8-10-25-11-9-19/h1-7,13,17,19,25H,8-12,14,22H2,(H3,23,24)/t17-/m0/s1 |
| InChIKey | LAWHZERUFJCAMY-KRWDZBQOSA-N |
| XLogP | 2.05 |
| TPSA | 106.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|