C29H37ClN4O3 — CID 22241137
ethyl 4-[4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate;hydrochloride (PubChem CID 22241137) has the molecular formula C29H37ClN4O3 and a molecular weight of 525.09 g/mol. Its IUPAC name is ethyl 4-[4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate;hydrochloride.
| Compound Name | ethyl 4-[4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate;hydrochloride |
|---|---|
| PubChem CID | 22241137 |
| Molecular Formula | C29H37ClN4O3 |
| Molecular Weight | 525.09 g/mol |
| Exact Mass | 524.26 |
| IUPAC Name | ethyl 4-[4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(N(C)CC#Cc2ccc(N(C(=O)CCC(=O)OCC)C3CCCC3)c(C)c2)c1 |
| InChI | InChI=1S/C29H36N4O3.ClH/c1-4-36-28(35)17-16-27(34)33(24-11-5-6-12-24)26-15-14-22(19-21(26)2)9-8-18-32(3)25-13-7-10-23(20-25)29(30)31;/h7,10,13-15,19-20,24H,4-6,11-12,16-18H2,1-3H3,(H3,30,31);1H |
| InChIKey | HNNNLLCDACQZDF-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.09 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|