C21H23IN2O5 — CID 22917003
methyl 3-[3-ethoxy-1-[[5-iodo-2-(methylamino)benzoyl]amino]-3-oxopropyl]benzoate (PubChem CID 22917003) has the molecular formula C21H23IN2O5 and a molecular weight of 510.33 g/mol. Its IUPAC name is methyl 3-[3-ethoxy-1-[[5-iodo-2-(methylamino)benzoyl]amino]-3-oxopropyl]benzoate.
| Compound Name | methyl 3-[3-ethoxy-1-[[5-iodo-2-(methylamino)benzoyl]amino]-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 22917003 |
| Molecular Formula | C21H23IN2O5 |
| Molecular Weight | 510.33 g/mol |
| Exact Mass | 510.07 |
| IUPAC Name | methyl 3-[3-ethoxy-1-[[5-iodo-2-(methylamino)benzoyl]amino]-3-oxopropyl]benzoate |
| SMILES | CCOC(=O)CC(NC(=O)c1cc(I)ccc1NC)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C21H23IN2O5/c1-4-29-19(25)12-18(13-6-5-7-14(10-13)21(27)28-3)24-20(26)16-11-15(22)8-9-17(16)23-2/h5-11,18,23H,4,12H2,1-3H3,(H,24,26) |
| InChIKey | OEAPJGPWXXPPDH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|