C21H25IN2O3 — CID 22905305
ethyl 3-[(3-amino-5-iodo-2-propan-2-ylbenzoyl)amino]-3-phenylpropanoate (PubChem CID 22905305) has the molecular formula C21H25IN2O3 and a molecular weight of 480.35 g/mol. Its IUPAC name is ethyl 3-[(3-amino-5-iodo-2-propan-2-ylbenzoyl)amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[(3-amino-5-iodo-2-propan-2-ylbenzoyl)amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 22905305 |
| Molecular Formula | C21H25IN2O3 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 480.09 |
| IUPAC Name | ethyl 3-[(3-amino-5-iodo-2-propan-2-ylbenzoyl)amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1cc(I)cc(N)c1C(C)C)c1ccccc1 |
| InChI | InChI=1S/C21H25IN2O3/c1-4-27-19(25)12-18(14-8-6-5-7-9-14)24-21(26)16-10-15(22)11-17(23)20(16)13(2)3/h5-11,13,18H,4,12,23H2,1-3H3,(H,24,26) |
| InChIKey | OPWTXCPZXNCAOT-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|