C26H25FN2O4 — CID 60590432
ethyl 3-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]-3-phenylpropanoate (PubChem CID 60590432) has the molecular formula C26H25FN2O4 and a molecular weight of 448.49 g/mol. Its IUPAC name is ethyl 3-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 60590432 |
| Molecular Formula | C26H25FN2O4 |
| Molecular Weight | 448.49 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | ethyl 3-[[3-[(2-fluorobenzoyl)amino]-4-methylbenzoyl]amino]-3-phenylpropanoate |
| SMILES | CCOC(=O)CC(NC(=O)c1ccc(C)c(NC(=O)c2ccccc2F)c1)c1ccccc1 |
| InChI | InChI=1S/C26H25FN2O4/c1-3-33-24(30)16-23(18-9-5-4-6-10-18)29-25(31)19-14-13-17(2)22(15-19)28-26(32)20-11-7-8-12-21(20)27/h4-15,23H,3,16H2,1-2H3,(H,28,32)(H,29,31) |
| InChIKey | DIXRQHOWYZJEPQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |