C26H21FN2O3 — CID 55687173
3-[(2-fluorobenzoyl)amino]-N-[furan-2-yl(phenyl)methyl]-4-methylbenzamide (PubChem CID 55687173) has the molecular formula C26H21FN2O3 and a molecular weight of 428.46 g/mol. Its IUPAC name is 3-[(2-fluorobenzoyl)amino]-N-[furan-2-yl(phenyl)methyl]-4-methylbenzamide.
| Compound Name | 3-[(2-fluorobenzoyl)amino]-N-[furan-2-yl(phenyl)methyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 55687173 |
| Molecular Formula | C26H21FN2O3 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.15 |
| IUPAC Name | 3-[(2-fluorobenzoyl)amino]-N-[furan-2-yl(phenyl)methyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC(c2ccccc2)c2ccco2)cc1NC(=O)c1ccccc1F |
| InChI | InChI=1S/C26H21FN2O3/c1-17-13-14-19(16-22(17)28-26(31)20-10-5-6-11-21(20)27)25(30)29-24(23-12-7-15-32-23)18-8-3-2-4-9-18/h2-16,24H,1H3,(H,28,31)(H,29,30) |
| InChIKey | AVKOMVTWXYKTFI-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |