C31H38N4O5 — CID 57135617
methyl 3-[4-[3-[4-(N'-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-N-(cyclopropanecarbonyl)-2,5-dimethylanilino]propanoate (PubChem CID 57135617) has the molecular formula C31H38N4O5 and a molecular weight of 546.67 g/mol. Its IUPAC name is methyl 3-[4-[3-[4-(N'-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-N-(cyclopropanecarbonyl)-2,5-dimethylanilino]propanoate.
| Compound Name | methyl 3-[4-[3-[4-(N'-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-N-(cyclopropanecarbonyl)-2,5-dimethylanilino]propanoate |
|---|---|
| PubChem CID | 57135617 |
| Molecular Formula | C31H38N4O5 |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.28 |
| IUPAC Name | methyl 3-[4-[3-[4-(N'-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-N-(cyclopropanecarbonyl)-2,5-dimethylanilino]propanoate |
| SMILES | CCCCOC(=O)N=C(N)c1ccc(NCC#Cc2cc(C)c(N(CCC(=O)OC)C(=O)C3CC3)cc2C)cc1 |
| InChI | InChI=1S/C31H38N4O5/c1-5-6-18-40-31(38)34-29(32)23-11-13-26(14-12-23)33-16-7-8-25-19-22(3)27(20-21(25)2)35(17-15-28(36)39-4)30(37)24-9-10-24/h11-14,19-20,24,33H,5-6,9-10,15-18H2,1-4H3,(H2,32,34,38) |
| InChIKey | ZJIXXOQNFLIQEL-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|