C27H30N4O4 — CID 57236126
butyl N-[amino-[4-[3-[3-formyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate (PubChem CID 57236126) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is butyl N-[amino-[4-[3-[3-formyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate.
| Compound Name | butyl N-[amino-[4-[3-[3-formyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 57236126 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | butyl N-[amino-[4-[3-[3-formyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
| SMILES | CCCCOC(=O)N=C(N)c1ccc(NCC#Cc2ccc(C(=O)N3CCCC3)c(C=O)c2)cc1 |
| InChI | InChI=1S/C27H30N4O4/c1-2-3-17-35-27(34)30-25(28)21-9-11-23(12-10-21)29-14-6-7-20-8-13-24(22(18-20)19-32)26(33)31-15-4-5-16-31/h8-13,18-19,29H,2-5,14-17H2,1H3,(H2,28,30,34) |
| InChIKey | YGAMAZJQGYXKKN-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|