C27H32N4O3 — CID 173277310
butyl N-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate (PubChem CID 173277310) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is butyl N-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate.
| Compound Name | butyl N-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173277310 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | butyl N-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCCCC)c1ccc(NCC#Cc2ccc(C(=O)N3CCCC3C)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O3/c1-3-4-19-34-27(33)30-25(28)22-13-15-24(16-14-22)29-17-5-8-21-9-11-23(12-10-21)26(32)31-18-6-7-20(31)2/h9-16,20,29H,3-4,6-7,17-19H2,1-2H3,(H2,28,30,33) |
| InChIKey | BDSLOAXHRHQDOB-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 94.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|