C27H32N4O4 — CID 173277542
butyl N-[4-[3-[3-methyl-4-(morpholine-4-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate (PubChem CID 173277542) has the molecular formula C27H32N4O4 and a molecular weight of 476.58 g/mol. Its IUPAC name is butyl N-[4-[3-[3-methyl-4-(morpholine-4-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate.
| Compound Name | butyl N-[4-[3-[3-methyl-4-(morpholine-4-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate |
|---|---|
| PubChem CID | 173277542 |
| Molecular Formula | C27H32N4O4 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | butyl N-[4-[3-[3-methyl-4-(morpholine-4-carbonyl)phenyl]prop-2-ynylamino]benzenecarboximidoyl]carbamate |
| SMILES | [H]/N=C(\NC(=O)OCCCC)c1ccc(NCC#Cc2ccc(C(=O)N3CCOCC3)c(C)c2)cc1 |
| InChI | InChI=1S/C27H32N4O4/c1-3-4-16-35-27(33)30-25(28)22-8-10-23(11-9-22)29-13-5-6-21-7-12-24(20(2)19-21)26(32)31-14-17-34-18-15-31/h7-12,19,29H,3-4,13-18H2,1-2H3,(H2,28,30,33) |
| InChIKey | LSYQLQDJDSNUDK-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|