C15H17NO3 — CID 18404856
[4-(3-hydroxyprop-1-ynyl)-2-methylphenyl]-morpholin-4-ylmethanone (PubChem CID 18404856) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is [4-(3-hydroxyprop-1-ynyl)-2-methylphenyl]-morpholin-4-ylmethanone.
| Compound Name | [4-(3-hydroxyprop-1-ynyl)-2-methylphenyl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 18404856 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | [4-(3-hydroxyprop-1-ynyl)-2-methylphenyl]-morpholin-4-ylmethanone |
| SMILES | Cc1cc(C#CCO)ccc1C(=O)N1CCOCC1 |
| InChI | InChI=1S/C15H17NO3/c1-12-11-13(3-2-8-17)4-5-14(12)15(18)16-6-9-19-10-7-16/h4-5,11,17H,6-10H2,1H3 |
| InChIKey | SIFBITVLEXJDOP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|