2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid

C10H8O4 — CID 169485255

IUPAC2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid
SMILESO=C(O)c1ccc(C#CCO)cc1O
InChIInChI=1S/C10H8O4/c11-5-1-2-7-3-4-8(10(13)14)9(12)6-7/h3-4,6,11-12H,5H2,(H,13,14)
InChIKeyUCCUWSJWMKTRFX-UHFFFAOYSA-N
MW192.17 g/mol
LogP0.43
Rot. Bonds1

About 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid

2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid (PubChem CID 169485255) has the molecular formula C10H8O4 and a molecular weight of 192.17 g/mol. Its IUPAC name is 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid.

Molecular Properties

Compound Name2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid
PubChem CID169485255
Molecular FormulaC10H8O4
Molecular Weight192.17 g/mol
Exact Mass192.04
IUPAC Name2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid
SMILESO=C(O)c1ccc(C#CCO)cc1O
InChIInChI=1S/C10H8O4/c11-5-1-2-7-3-4-8(10(13)14)9(12)6-7/h3-4,6,11-12H,5H2,(H,13,14)
InChIKeyUCCUWSJWMKTRFX-UHFFFAOYSA-N
XLogP0.43
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.17
LogP ≤ 50.43
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid?
The IUPAC name of 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid (CID 169485255) is 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid.
What is the SMILES notation for 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid?
The canonical SMILES for 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid is O=C(O)c1ccc(C#CCO)cc1O.
What is the InChIKey of 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid?
The InChIKey is UCCUWSJWMKTRFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4/c11-5-1-2-7-3-4-8(10(13)14)9(12)6-7/h3-4,6,11-12H,5H2,(H,13,14).
What are the key properties of 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid?
2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid has a molecular weight of 192.17 g/mol, XLogP of 0.43, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxy-4-(3-hydroxyprop-1-ynyl)benzoic acid is sourced from PubChem (CID 169485255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).