C13H12O5 — CID 155584054
dimethyl 4-(3-hydroxyprop-1-ynyl)benzene-1,2-dicarboxylate (PubChem CID 155584054) has the molecular formula C13H12O5 and a molecular weight of 248.23 g/mol. Its IUPAC name is dimethyl 4-(3-hydroxyprop-1-ynyl)benzene-1,2-dicarboxylate.
| Compound Name | dimethyl 4-(3-hydroxyprop-1-ynyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 155584054 |
| Molecular Formula | C13H12O5 |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.07 |
| IUPAC Name | dimethyl 4-(3-hydroxyprop-1-ynyl)benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccc(C#CCO)cc1C(=O)OC |
| InChI | InChI=1S/C13H12O5/c1-17-12(15)10-6-5-9(4-3-7-14)8-11(10)13(16)18-2/h5-6,8,14H,7H2,1-2H3 |
| InChIKey | DRKHXKCQUWCVPV-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|