C37H51N5O7 — CID 173277499
ethyl 4-[4-[3-[4-(N-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-2,5-dimethyl-N-propan-2-ylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate (PubChem CID 173277499) has the molecular formula C37H51N5O7 and a molecular weight of 677.84 g/mol. Its IUPAC name is ethyl 4-[4-[3-[4-(N-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-2,5-dimethyl-N-propan-2-ylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[3-[4-(N-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-2,5-dimethyl-N-propan-2-ylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
|---|---|
| PubChem CID | 173277499 |
| Molecular Formula | C37H51N5O7 |
| Molecular Weight | 677.84 g/mol |
| Exact Mass | 677.38 |
| IUPAC Name | ethyl 4-[4-[3-[4-(N-butoxycarbonylcarbamimidoyl)anilino]prop-1-ynyl]-2,5-dimethyl-N-propan-2-ylanilino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxobutanoate |
| SMILES | [H]/N=C(\NC(=O)OCCCC)c1ccc(NCC#Cc2cc(C)c(N(C(=O)CC(NC(=O)OC(C)(C)C)C(=O)OCC)C(C)C)cc2C)cc1 |
| InChI | InChI=1S/C37H51N5O7/c1-10-12-20-48-35(45)41-33(38)27-15-17-29(18-16-27)39-19-13-14-28-21-26(6)31(22-25(28)5)42(24(3)4)32(43)23-30(34(44)47-11-2)40-36(46)49-37(7,8)9/h15-18,21-22,24,30,39H,10-12,19-20,23H2,1-9H3,(H,40,46)(H2,38,41,45) |
| InChIKey | YQJCHUDXSWJJER-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 159.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.84 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|