C28H36N4O3 — CID 18405031
tert-butyl (NE)-N-[amino-[4-[3-[4-(diethylcarbamoyl)-2,5-dimethylphenyl]prop-2-ynylamino]phenyl]methylidene]carbamate (PubChem CID 18405031) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino-[4-[3-[4-(diethylcarbamoyl)-2,5-dimethylphenyl]prop-2-ynylamino]phenyl]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino-[4-[3-[4-(diethylcarbamoyl)-2,5-dimethylphenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 18405031 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | tert-butyl (NE)-N-[amino-[4-[3-[4-(diethylcarbamoyl)-2,5-dimethylphenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
| SMILES | CCN(CC)C(=O)c1cc(C)c(C#CCNc2ccc(/C(N)=N\C(=O)OC(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C28H36N4O3/c1-8-32(9-2)26(33)24-18-19(3)22(17-20(24)4)11-10-16-30-23-14-12-21(13-15-23)25(29)31-27(34)35-28(5,6)7/h12-15,17-18,30H,8-9,16H2,1-7H3,(H2,29,31,34) |
| InChIKey | UVDDNBXDWXRMII-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|