C27H32N4O3 — CID 18405010
tert-butyl (NE)-N-[amino-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate (PubChem CID 18405010) has the molecular formula C27H32N4O3 and a molecular weight of 460.58 g/mol. Its IUPAC name is tert-butyl (NE)-N-[amino-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate.
| Compound Name | tert-butyl (NE)-N-[amino-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
|---|---|
| PubChem CID | 18405010 |
| Molecular Formula | C27H32N4O3 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | tert-butyl (NE)-N-[amino-[4-[3-[4-(2-methylpyrrolidine-1-carbonyl)phenyl]prop-2-ynylamino]phenyl]methylidene]carbamate |
| SMILES | CC1CCCN1C(=O)c1ccc(C#CCNc2ccc(/C(N)=N\C(=O)OC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C27H32N4O3/c1-19-7-6-18-31(19)25(32)22-11-9-20(10-12-22)8-5-17-29-23-15-13-21(14-16-23)24(28)30-26(33)34-27(2,3)4/h9-16,19,29H,6-7,17-18H2,1-4H3,(H2,28,30,33) |
| InChIKey | OKXCWTIBOYBDBW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|