C22H19N3O — CID 22241133
3-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynylamino]benzonitrile (PubChem CID 22241133) has the molecular formula C22H19N3O and a molecular weight of 341.41 g/mol. Its IUPAC name is 3-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynylamino]benzonitrile.
| Compound Name | 3-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynylamino]benzonitrile |
|---|---|
| PubChem CID | 22241133 |
| Molecular Formula | C22H19N3O |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 3-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynylamino]benzonitrile |
| SMILES | Cc1cc(C#CCNc2cccc(C#N)c2)ccc1C(=O)N1CC=CC1 |
| InChI | InChI=1S/C22H19N3O/c1-17-14-18(9-10-21(17)22(26)25-12-2-3-13-25)7-5-11-24-20-8-4-6-19(15-20)16-23/h2-4,6,8-10,14-15,24H,11-13H2,1H3 |
| InChIKey | QTPOLNHUVADSHF-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|