C27H27N3O3 — CID 22241051
ethyl 3-[3-cyano-N-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynyl]anilino]propanoate (PubChem CID 22241051) has the molecular formula C27H27N3O3 and a molecular weight of 441.53 g/mol. Its IUPAC name is ethyl 3-[3-cyano-N-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynyl]anilino]propanoate.
| Compound Name | ethyl 3-[3-cyano-N-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynyl]anilino]propanoate |
|---|---|
| PubChem CID | 22241051 |
| Molecular Formula | C27H27N3O3 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | ethyl 3-[3-cyano-N-[3-[4-(2,5-dihydropyrrole-1-carbonyl)-3-methylphenyl]prop-2-ynyl]anilino]propanoate |
| SMILES | CCOC(=O)CCN(CC#Cc1ccc(C(=O)N2CC=CC2)c(C)c1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C27H27N3O3/c1-3-33-26(31)13-17-29(24-10-6-8-23(19-24)20-28)16-7-9-22-11-12-25(21(2)18-22)27(32)30-14-4-5-15-30/h4-6,8,10-12,18-19H,3,13-17H2,1-2H3 |
| InChIKey | ZHVQEROJLTVRKL-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|