C29H30N4O — CID 22241063
3-[benzyl-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]amino]benzenecarboximidamide (PubChem CID 22241063) has the molecular formula C29H30N4O and a molecular weight of 450.59 g/mol. Its IUPAC name is 3-[benzyl-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]amino]benzenecarboximidamide.
| Compound Name | 3-[benzyl-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 22241063 |
| Molecular Formula | C29H30N4O |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.24 |
| IUPAC Name | 3-[benzyl-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(CC#Cc2ccc(C(=O)N3CCCC3)c(C)c2)Cc2ccccc2)c1 |
| InChI | InChI=1S/C29H30N4O/c1-22-19-23(14-15-27(22)29(34)32-16-5-6-17-32)11-8-18-33(21-24-9-3-2-4-10-24)26-13-7-12-25(20-26)28(30)31/h2-4,7,9-10,12-15,19-20H,5-6,16-18,21H2,1H3,(H3,30,31) |
| InChIKey | LIZBMRIIIFSOTR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 73.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|