C31H33ClN4O3 — CID 22241135
methyl 3-[[3-carbamimidoyl-N-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]anilino]methyl]benzoate;hydrochloride (PubChem CID 22241135) has the molecular formula C31H33ClN4O3 and a molecular weight of 545.08 g/mol. Its IUPAC name is methyl 3-[[3-carbamimidoyl-N-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]anilino]methyl]benzoate;hydrochloride.
| Compound Name | methyl 3-[[3-carbamimidoyl-N-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]anilino]methyl]benzoate;hydrochloride |
|---|---|
| PubChem CID | 22241135 |
| Molecular Formula | C31H33ClN4O3 |
| Molecular Weight | 545.08 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | methyl 3-[[3-carbamimidoyl-N-[3-[3-methyl-4-(pyrrolidine-1-carbonyl)phenyl]prop-2-ynyl]anilino]methyl]benzoate;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1cccc(N(CC#Cc2ccc(C(=O)N3CCCC3)c(C)c2)Cc2cccc(C(=O)OC)c2)c1 |
| InChI | InChI=1S/C31H32N4O3.ClH/c1-22-18-23(13-14-28(22)30(36)34-15-3-4-16-34)9-7-17-35(27-12-6-10-25(20-27)29(32)33)21-24-8-5-11-26(19-24)31(37)38-2;/h5-6,8,10-14,18-20H,3-4,15-17,21H2,1-2H3,(H3,32,33);1H |
| InChIKey | UIMQMICPOCLHHL-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 99.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.08 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|