C23H26N4O — CID 22241125
N-but-3-enyl-4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-2-methylbenzamide (PubChem CID 22241125) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is N-but-3-enyl-4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-2-methylbenzamide.
| Compound Name | N-but-3-enyl-4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 22241125 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | N-but-3-enyl-4-[3-(3-carbamimidoyl-N-methylanilino)prop-1-ynyl]-2-methylbenzamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)CC#Cc2ccc(C(=O)NCCC=C)c(C)c2)c1 |
| InChI | InChI=1S/C23H26N4O/c1-4-5-13-26-23(28)21-12-11-18(15-17(21)2)8-7-14-27(3)20-10-6-9-19(16-20)22(24)25/h4,6,9-12,15-16H,1,5,13-14H2,2-3H3,(H3,24,25)(H,26,28) |
| InChIKey | KFJUBXUOBMCQQZ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|