C25H30N4O — CID 142834641
3-[3-[4-[(1-acetylcyclopentyl)-methylamino]-3-methylphenyl]prop-2-ynylamino]benzenecarboximidamide (PubChem CID 142834641) has the molecular formula C25H30N4O and a molecular weight of 402.54 g/mol. Its IUPAC name is 3-[3-[4-[(1-acetylcyclopentyl)-methylamino]-3-methylphenyl]prop-2-ynylamino]benzenecarboximidamide.
| Compound Name | 3-[3-[4-[(1-acetylcyclopentyl)-methylamino]-3-methylphenyl]prop-2-ynylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 142834641 |
| Molecular Formula | C25H30N4O |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.24 |
| IUPAC Name | 3-[3-[4-[(1-acetylcyclopentyl)-methylamino]-3-methylphenyl]prop-2-ynylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(NCC#Cc2ccc(N(C)C3(C(C)=O)CCCC3)c(C)c2)c1 |
| InChI | InChI=1S/C25H30N4O/c1-18-16-20(8-7-15-28-22-10-6-9-21(17-22)24(26)27)11-12-23(18)29(3)25(19(2)30)13-4-5-14-25/h6,9-12,16-17,28H,4-5,13-15H2,1-3H3,(H3,26,27) |
| InChIKey | ZKCGJBQIPVSKJX-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 82.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|