C11H17N3 — CID 62970999
3-[methyl(propyl)amino]benzenecarboximidamide (PubChem CID 62970999) has the molecular formula C11H17N3 and a molecular weight of 191.28 g/mol. Its IUPAC name is 3-[methyl(propyl)amino]benzenecarboximidamide.
| Compound Name | 3-[methyl(propyl)amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 62970999 |
| Molecular Formula | C11H17N3 |
| Molecular Weight | 191.28 g/mol |
| Exact Mass | 191.14 |
| IUPAC Name | 3-[methyl(propyl)amino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)CCC)c1 |
| InChI | InChI=1S/C11H17N3/c1-3-7-14(2)10-6-4-5-9(8-10)11(12)13/h4-6,8H,3,7H2,1-2H3,(H3,12,13) |
| InChIKey | MYAZFRWDBQLQFH-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.28 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|