C15H15F2N3 — CID 62970652
3-[(2,4-difluorophenyl)methyl-methylamino]benzenecarboximidamide (PubChem CID 62970652) has the molecular formula C15H15F2N3 and a molecular weight of 275.30 g/mol. Its IUPAC name is 3-[(2,4-difluorophenyl)methyl-methylamino]benzenecarboximidamide.
| Compound Name | 3-[(2,4-difluorophenyl)methyl-methylamino]benzenecarboximidamide |
|---|---|
| PubChem CID | 62970652 |
| Molecular Formula | C15H15F2N3 |
| Molecular Weight | 275.30 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 3-[(2,4-difluorophenyl)methyl-methylamino]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cccc(N(C)Cc2ccc(F)cc2F)c1 |
| InChI | InChI=1S/C15H15F2N3/c1-20(9-11-5-6-12(16)8-14(11)17)13-4-2-3-10(7-13)15(18)19/h2-8H,9H2,1H3,(H3,18,19) |
| InChIKey | DHFBRTAUIRERTR-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|