C17H21N3O — CID 114483506
4-[(3-methoxy-N-methylanilino)methyl]-3-methylbenzenecarboximidamide (PubChem CID 114483506) has the molecular formula C17H21N3O and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-[(3-methoxy-N-methylanilino)methyl]-3-methylbenzenecarboximidamide.
| Compound Name | 4-[(3-methoxy-N-methylanilino)methyl]-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114483506 |
| Molecular Formula | C17H21N3O |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.17 |
| IUPAC Name | 4-[(3-methoxy-N-methylanilino)methyl]-3-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(C)c2cccc(OC)c2)c(C)c1 |
| InChI | InChI=1S/C17H21N3O/c1-12-9-13(17(18)19)7-8-14(12)11-20(2)15-5-4-6-16(10-15)21-3/h4-10H,11H2,1-3H3,(H3,18,19) |
| InChIKey | DNENXGBFYXYQMY-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 62.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|