C17H21N3 — CID 114483514
4-[(N,4-dimethylanilino)methyl]-3-methylbenzenecarboximidamide (PubChem CID 114483514) has the molecular formula C17H21N3 and a molecular weight of 267.38 g/mol. Its IUPAC name is 4-[(N,4-dimethylanilino)methyl]-3-methylbenzenecarboximidamide.
| Compound Name | 4-[(N,4-dimethylanilino)methyl]-3-methylbenzenecarboximidamide |
|---|---|
| PubChem CID | 114483514 |
| Molecular Formula | C17H21N3 |
| Molecular Weight | 267.38 g/mol |
| Exact Mass | 267.17 |
| IUPAC Name | 4-[(N,4-dimethylanilino)methyl]-3-methylbenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(C)c2ccc(C)cc2)c(C)c1 |
| InChI | InChI=1S/C17H21N3/c1-12-4-8-16(9-5-12)20(3)11-15-7-6-14(17(18)19)10-13(15)2/h4-10H,11H2,1-3H3,(H3,18,19) |
| InChIKey | WVTRTXSODYFQNK-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|