C17H20FN3 — CID 61075864
4-[(N-ethyl-3-methylanilino)methyl]-3-fluorobenzenecarboximidamide (PubChem CID 61075864) has the molecular formula C17H20FN3 and a molecular weight of 285.37 g/mol. Its IUPAC name is 4-[(N-ethyl-3-methylanilino)methyl]-3-fluorobenzenecarboximidamide.
| Compound Name | 4-[(N-ethyl-3-methylanilino)methyl]-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 61075864 |
| Molecular Formula | C17H20FN3 |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.16 |
| IUPAC Name | 4-[(N-ethyl-3-methylanilino)methyl]-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN(CC)c2cccc(C)c2)c(F)c1 |
| InChI | InChI=1S/C17H20FN3/c1-3-21(15-6-4-5-12(2)9-15)11-14-8-7-13(17(19)20)10-16(14)18/h4-10H,3,11H2,1-2H3,(H3,19,20) |
| InChIKey | VDLUUCDTWQCIRF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|