C12H21Cl2N3 — CID 42614728
3-(N-ethyl-3-methylanilino)propanimidamide;dihydrochloride (PubChem CID 42614728) has the molecular formula C12H21Cl2N3 and a molecular weight of 278.23 g/mol. Its IUPAC name is 3-(N-ethyl-3-methylanilino)propanimidamide;dihydrochloride.
| Compound Name | 3-(N-ethyl-3-methylanilino)propanimidamide;dihydrochloride |
|---|---|
| PubChem CID | 42614728 |
| Molecular Formula | C12H21Cl2N3 |
| Molecular Weight | 278.23 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 3-(N-ethyl-3-methylanilino)propanimidamide;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C(\N)CCN(CC)c1cccc(C)c1 |
| InChI | InChI=1S/C12H19N3.2ClH/c1-3-15(8-7-12(13)14)11-6-4-5-10(2)9-11;;/h4-6,9H,3,7-8H2,1-2H3,(H3,13,14);2*1H |
| InChIKey | QBNYHKMKRCXXRT-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.23 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|