C29H33N3O3 — CID 22241124
ethyl 4-[4-[3-(3-cyano-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate (PubChem CID 22241124) has the molecular formula C29H33N3O3 and a molecular weight of 471.60 g/mol. Its IUPAC name is ethyl 4-[4-[3-(3-cyano-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate.
| Compound Name | ethyl 4-[4-[3-(3-cyano-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate |
|---|---|
| PubChem CID | 22241124 |
| Molecular Formula | C29H33N3O3 |
| Molecular Weight | 471.60 g/mol |
| Exact Mass | 471.25 |
| IUPAC Name | ethyl 4-[4-[3-(3-cyano-N-methylanilino)prop-1-ynyl]-N-cyclopentyl-2-methylanilino]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)N(c1ccc(C#CCN(C)c2cccc(C#N)c2)cc1C)C1CCCC1 |
| InChI | InChI=1S/C29H33N3O3/c1-4-35-29(34)17-16-28(33)32(25-11-5-6-12-25)27-15-14-23(19-22(27)2)10-8-18-31(3)26-13-7-9-24(20-26)21-30/h7,9,13-15,19-20,25H,4-6,11-12,16-18H2,1-3H3 |
| InChIKey | VICPVCYUUPVUTF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.60 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|