About 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane
3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane (PubChem CID 171541289) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane.
Molecular Properties
| Compound Name | 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane |
| PubChem CID | 171541289 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane |
| SMILES | CCC1CC1.CN(CN)c1cccc(C#N)c1 |
| InChI | InChI=1S/C9H11N3.C5H10/c1-12(7-11)9-4-2-3-8(5-9)6-10;1-2-5-3-4-5/h2-5H,7,11H2,1H3;5H,2-4H2,1H3 |
| InChIKey | SAFIDLKDQSKPOA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane?
The IUPAC name of 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane (CID 171541289) is 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane.
What is the SMILES notation for 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane?
The canonical SMILES for 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane is CCC1CC1.CN(CN)c1cccc(C#N)c1.
What is the InChIKey of 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane?
The InChIKey is SAFIDLKDQSKPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3.C5H10/c1-12(7-11)9-4-2-3-8(5-9)6-10;1-2-5-3-4-5/h2-5H,7,11H2,1H3;5H,2-4H2,1H3.
What are the key properties of 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane?
3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane has a molecular weight of 231.34 g/mol, XLogP of 2.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[aminomethyl(methyl)amino]benzonitrile;ethylcyclopropane is sourced from PubChem (CID 171541289), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).